C8HCl7 — CID 6434060
1,2,3,4,5-pentachloro-6-[(Z)-1,2-dichloroethenyl]benzene (PubChem CID 6434060) has the molecular formula C8HCl7 and a molecular weight of 345.27 g/mol. Its IUPAC name is 1,2,3,4,5-pentachloro-6-[(Z)-1,2-dichloroethenyl]benzene.
| Compound Name | 1,2,3,4,5-pentachloro-6-[(Z)-1,2-dichloroethenyl]benzene |
|---|---|
| PubChem CID | 6434060 |
| Molecular Formula | C8HCl7 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 341.79 |
| IUPAC Name | 1,2,3,4,5-pentachloro-6-[(Z)-1,2-dichloroethenyl]benzene |
| SMILES | Cl/C=C(\Cl)c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C8HCl7/c9-1-2(10)3-4(11)6(13)8(15)7(14)5(3)12/h1H/b2-1- |
| InChIKey | WOYBAAGBIXHIGK-UPHRSURJSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|