C22H25NO5 — CID 6434105
(Z)-4-hydroxy-4-oxobut-2-enoate;methyl-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyloxy)ethyl]azanium (PubChem CID 6434105) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is (Z)-4-hydroxy-4-oxobut-2-enoate;methyl-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyloxy)ethyl]azanium.
| Compound Name | (Z)-4-hydroxy-4-oxobut-2-enoate;methyl-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 6434105 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (Z)-4-hydroxy-4-oxobut-2-enoate;methyl-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenyloxy)ethyl]azanium |
| SMILES | C[NH2+]CCOC1c2ccccc2CCc2ccccc21.O=C([O-])/C=C\C(=O)O |
| InChI | InChI=1S/C18H21NO.C4H4O4/c1-19-12-13-20-18-16-8-4-2-6-14(16)10-11-15-7-3-5-9-17(15)18;5-3(6)1-2-4(7)8/h2-9,18-19H,10-13H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | AMDZXFZJWBFXIU-BTJKTKAUSA-N |
| XLogP | 0.46 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|