C14H14Cl3NO5 — CID 6434168
(Z)-4-hydroxy-4-oxobut-2-enoate;methyl-[(4,5,7-trichloro-2,3-dihydro-1-benzofuran-2-yl)methyl]azanium (PubChem CID 6434168) has the molecular formula C14H14Cl3NO5 and a molecular weight of 382.63 g/mol. Its IUPAC name is (Z)-4-hydroxy-4-oxobut-2-enoate;methyl-[(4,5,7-trichloro-2,3-dihydro-1-benzofuran-2-yl)methyl]azanium.
| Compound Name | (Z)-4-hydroxy-4-oxobut-2-enoate;methyl-[(4,5,7-trichloro-2,3-dihydro-1-benzofuran-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 6434168 |
| Molecular Formula | C14H14Cl3NO5 |
| Molecular Weight | 382.63 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | (Z)-4-hydroxy-4-oxobut-2-enoate;methyl-[(4,5,7-trichloro-2,3-dihydro-1-benzofuran-2-yl)methyl]azanium |
| SMILES | C[NH2+]CC1Cc2c(Cl)c(Cl)cc(Cl)c2O1.O=C([O-])/C=C\C(=O)O |
| InChI | InChI=1S/C10H10Cl3NO.C4H4O4/c1-14-4-5-2-6-9(13)7(11)3-8(12)10(6)15-5;5-3(6)1-2-4(7)8/h3,5,14H,2,4H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | ANDCBYJDHNGTOZ-BTJKTKAUSA-N |
| XLogP | 0.52 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.63 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|