About (5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl-methylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate
(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl-methylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate (PubChem CID 6434175) has the molecular formula C14H16ClNO5
and a molecular weight of 313.74 g/mol. Its IUPAC name is (5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl-methylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | (5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl-methylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate |
| PubChem CID | 6434175 |
| Molecular Formula | C14H16ClNO5 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | (5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl-methylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate |
| SMILES | C[NH2+]CC1Cc2cc(Cl)ccc2O1.O=C([O-])/C=C\C(=O)O |
| InChI | InChI=1S/C10H12ClNO.C4H4O4/c1-12-6-9-5-7-4-8(11)2-3-10(7)13-9;5-3(6)1-2-4(7)8/h2-4,9,12H,5-6H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | FGIKTYNIBAOPGF-BTJKTKAUSA-N |
| XLogP | -0.79 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl-methylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl-methylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate?
The IUPAC name of (5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl-methylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate (CID 6434175) is (5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl-methylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate.
What is the SMILES notation for (5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl-methylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate?
The canonical SMILES for (5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl-methylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate is C[NH2+]CC1Cc2cc(Cl)ccc2O1.O=C([O-])/C=C\C(=O)O.
What is the InChIKey of (5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl-methylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate?
The InChIKey is FGIKTYNIBAOPGF-BTJKTKAUSA-N. The full InChI is InChI=1S/C10H12ClNO.C4H4O4/c1-12-6-9-5-7-4-8(11)2-3-10(7)13-9;5-3(6)1-2-4(7)8/h2-4,9,12H,5-6H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1-.
What are the key properties of (5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl-methylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate?
(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl-methylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate has a molecular weight of 313.74 g/mol, XLogP of -0.79, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl-methylazanium;(Z)-4-hydroxy-4-oxobut-2-enoate is sourced from PubChem (CID 6434175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).