About (2S,5S)-2,5-di(propan-2-yl)-1,3-oxathiane
(2S,5S)-2,5-di(propan-2-yl)-1,3-oxathiane (PubChem CID 643432) has the molecular formula C10H20OS
and a molecular weight of 188.34 g/mol. Its IUPAC name is (2S,5S)-2,5-di(propan-2-yl)-1,3-oxathiane.
Molecular Properties
| Compound Name | (2S,5S)-2,5-di(propan-2-yl)-1,3-oxathiane |
| PubChem CID | 643432 |
| Molecular Formula | C10H20OS |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (2S,5S)-2,5-di(propan-2-yl)-1,3-oxathiane |
| SMILES | CC(C)[C@H]1CO[C@H](C(C)C)SC1 |
| InChI | InChI=1S/C10H20OS/c1-7(2)9-5-11-10(8(3)4)12-6-9/h7-10H,5-6H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | PUNCQJVOBVQLAA-UWVGGRQHSA-N |
| XLogP | 3.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,5S)-2,5-di(propan-2-yl)-1,3-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-2,5-di(propan-2-yl)-1,3-oxathiane?
The IUPAC name of (2S,5S)-2,5-di(propan-2-yl)-1,3-oxathiane (CID 643432) is (2S,5S)-2,5-di(propan-2-yl)-1,3-oxathiane.
What is the SMILES notation for (2S,5S)-2,5-di(propan-2-yl)-1,3-oxathiane?
The canonical SMILES for (2S,5S)-2,5-di(propan-2-yl)-1,3-oxathiane is CC(C)[C@H]1CO[C@H](C(C)C)SC1.
What is the InChIKey of (2S,5S)-2,5-di(propan-2-yl)-1,3-oxathiane?
The InChIKey is PUNCQJVOBVQLAA-UWVGGRQHSA-N. The full InChI is InChI=1S/C10H20OS/c1-7(2)9-5-11-10(8(3)4)12-6-9/h7-10H,5-6H2,1-4H3/t9-,10-/m0/s1.
What are the key properties of (2S,5S)-2,5-di(propan-2-yl)-1,3-oxathiane?
(2S,5S)-2,5-di(propan-2-yl)-1,3-oxathiane has a molecular weight of 188.34 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-2,5-di(propan-2-yl)-1,3-oxathiane is sourced from PubChem (CID 643432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).