C32H51NO8S — CID 6434500
(E)-but-2-enedioic acid;[(2R,3S,4S,6R,8S,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[2-(diethylamino)ethylsulfanyl]acetate (PubChem CID 6434500) has the molecular formula C32H51NO8S and a molecular weight of 609.83 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;[(2R,3S,4S,6R,8S,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[2-(diethylamino)ethylsulfanyl]acetate.
| Compound Name | (E)-but-2-enedioic acid;[(2R,3S,4S,6R,8S,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[2-(diethylamino)ethylsulfanyl]acetate |
|---|---|
| PubChem CID | 6434500 |
| Molecular Formula | C32H51NO8S |
| Molecular Weight | 609.83 g/mol |
| Exact Mass | 609.33 |
| IUPAC Name | (E)-but-2-enedioic acid;[(2R,3S,4S,6R,8S,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[2-(diethylamino)ethylsulfanyl]acetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSCCN(CC)CC)C2(C)[C@H](C)CCC3(CCC(=O)[C@@H]32)[C@@H](C)[C@@H]1O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C28H47NO4S.C4H4O4/c1-8-26(6)17-22(33-23(31)18-34-16-15-29(9-2)10-3)27(7)19(4)11-13-28(20(5)25(26)32)14-12-21(30)24(27)28;5-3(6)1-2-4(7)8/h8,19-20,22,24-25,32H,1,9-18H2,2-7H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t19-,20+,22-,24-,25+,26-,27?,28?;/m1./s1 |
| InChIKey | YXQXDXAHCSEVSD-LKNSULBJSA-N |
| XLogP | 4.68 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.83 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|