C15H24O3 — CID 6434549
(E)-3-hydroxy-3-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-5-enoic acid (PubChem CID 6434549) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (E)-3-hydroxy-3-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-5-enoic acid.
| Compound Name | (E)-3-hydroxy-3-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-5-enoic acid |
|---|---|
| PubChem CID | 6434549 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (E)-3-hydroxy-3-methyl-6-(2,2,3-trimethylcyclopent-3-en-1-yl)hex-5-enoic acid |
| SMILES | CC1=CCC(/C=C/CC(C)(O)CC(=O)O)C1(C)C |
| InChI | InChI=1S/C15H24O3/c1-11-7-8-12(14(11,2)3)6-5-9-15(4,18)10-13(16)17/h5-7,12,18H,8-10H2,1-4H3,(H,16,17)/b6-5+ |
| InChIKey | AYDHQKBQCJIHDT-AATRIKPKSA-N |
| XLogP | 3.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|