C28H33FN2O5 — CID 6434555
(Z)-but-2-enedioic acid;1-(4-fluorophenyl)-4-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)piperazin-1-yl]butan-1-one (PubChem CID 6434555) has the molecular formula C28H33FN2O5 and a molecular weight of 496.58 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-(4-fluorophenyl)-4-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)piperazin-1-yl]butan-1-one.
| Compound Name | (Z)-but-2-enedioic acid;1-(4-fluorophenyl)-4-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 6434555 |
| Molecular Formula | C28H33FN2O5 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-(4-fluorophenyl)-4-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)piperazin-1-yl]butan-1-one |
| SMILES | O=C(CCCN1CCN(c2ccc3c(c2)CCCC3)CC1)c1ccc(F)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C24H29FN2O.C4H4O4/c25-22-10-7-20(8-11-22)24(28)6-3-13-26-14-16-27(17-15-26)23-12-9-19-4-1-2-5-21(19)18-23;5-3(6)1-2-4(7)8/h7-12,18H,1-6,13-17H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | SXOPNYCIYICNNA-BTJKTKAUSA-N |
| XLogP | 4.20 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|