benzyl 2,5-dihydropyrrole-1-carboxylate

C12H13NO2 — CID 643471

IUPACbenzyl 2,5-dihydropyrrole-1-carboxylate
SMILESO=C(OCc1ccccc1)N1CC=CC1
InChIInChI=1S/C12H13NO2/c14-12(13-8-4-5-9-13)15-10-11-6-2-1-3-7-11/h1-7H,8-10H2
InChIKeyXSKKIFJNZPNVGO-UHFFFAOYSA-N
MW203.24 g/mol
LogP2.19
Rot. Bonds2

About benzyl 2,5-dihydropyrrole-1-carboxylate

benzyl 2,5-dihydropyrrole-1-carboxylate (PubChem CID 643471) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is benzyl 2,5-dihydropyrrole-1-carboxylate.

Molecular Properties

Compound Namebenzyl 2,5-dihydropyrrole-1-carboxylate
PubChem CID643471
Molecular FormulaC12H13NO2
Molecular Weight203.24 g/mol
Exact Mass203.09
IUPAC Namebenzyl 2,5-dihydropyrrole-1-carboxylate
SMILESO=C(OCc1ccccc1)N1CC=CC1
InChIInChI=1S/C12H13NO2/c14-12(13-8-4-5-9-13)15-10-11-6-2-1-3-7-11/h1-7H,8-10H2
InChIKeyXSKKIFJNZPNVGO-UHFFFAOYSA-N
XLogP2.19
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.24
LogP ≤ 52.19
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze benzyl 2,5-dihydropyrrole-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2,5-dihydropyrrole-1-carboxylate?
The IUPAC name of benzyl 2,5-dihydropyrrole-1-carboxylate (CID 643471) is benzyl 2,5-dihydropyrrole-1-carboxylate.
What is the SMILES notation for benzyl 2,5-dihydropyrrole-1-carboxylate?
The canonical SMILES for benzyl 2,5-dihydropyrrole-1-carboxylate is O=C(OCc1ccccc1)N1CC=CC1.
What is the InChIKey of benzyl 2,5-dihydropyrrole-1-carboxylate?
The InChIKey is XSKKIFJNZPNVGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c14-12(13-8-4-5-9-13)15-10-11-6-2-1-3-7-11/h1-7H,8-10H2.
What are the key properties of benzyl 2,5-dihydropyrrole-1-carboxylate?
benzyl 2,5-dihydropyrrole-1-carboxylate has a molecular weight of 203.24 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2,5-dihydropyrrole-1-carboxylate is sourced from PubChem (CID 643471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).