About (2-chlorophenyl)methyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate
(2-chlorophenyl)methyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate (PubChem CID 6434810) has the molecular formula C13H16ClO6P
and a molecular weight of 334.69 g/mol. Its IUPAC name is (2-chlorophenyl)methyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate.
Molecular Properties
| Compound Name | (2-chlorophenyl)methyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate |
| PubChem CID | 6434810 |
| Molecular Formula | C13H16ClO6P |
| Molecular Weight | 334.69 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | (2-chlorophenyl)methyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate |
| SMILES | COP(=O)(OC)O/C(C)=C\C(=O)OCc1ccccc1Cl |
| InChI | InChI=1S/C13H16ClO6P/c1-10(20-21(16,17-2)18-3)8-13(15)19-9-11-6-4-5-7-12(11)14/h4-8H,9H2,1-3H3/b10-8- |
| InChIKey | AEKQPEXBWPJBEH-NTMALXAHSA-N |
| XLogP | 3.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.69 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-chlorophenyl)methyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)methyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate?
The IUPAC name of (2-chlorophenyl)methyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate (CID 6434810) is (2-chlorophenyl)methyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate.
What is the SMILES notation for (2-chlorophenyl)methyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate?
The canonical SMILES for (2-chlorophenyl)methyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate is COP(=O)(OC)O/C(C)=C\C(=O)OCc1ccccc1Cl.
What is the InChIKey of (2-chlorophenyl)methyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate?
The InChIKey is AEKQPEXBWPJBEH-NTMALXAHSA-N. The full InChI is InChI=1S/C13H16ClO6P/c1-10(20-21(16,17-2)18-3)8-13(15)19-9-11-6-4-5-7-12(11)14/h4-8H,9H2,1-3H3/b10-8-.
What are the key properties of (2-chlorophenyl)methyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate?
(2-chlorophenyl)methyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate has a molecular weight of 334.69 g/mol, XLogP of 3.70, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)methyl (Z)-3-dimethoxyphosphoryloxybut-2-enoate is sourced from PubChem (CID 6434810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).