C28H42N2O2 — CID 6434946
2-[4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazin-1-yl]ethyl benzoate (PubChem CID 6434946) has the molecular formula C28H42N2O2 and a molecular weight of 438.66 g/mol. Its IUPAC name is 2-[4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazin-1-yl]ethyl benzoate.
| Compound Name | 2-[4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazin-1-yl]ethyl benzoate |
|---|---|
| PubChem CID | 6434946 |
| Molecular Formula | C28H42N2O2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | 2-[4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]piperazin-1-yl]ethyl benzoate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CN1CCN(CCOC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H42N2O2/c1-24(2)10-8-11-25(3)12-9-13-26(4)16-17-29-18-20-30(21-19-29)22-23-32-28(31)27-14-6-5-7-15-27/h5-7,10,12,14-16H,8-9,11,13,17-23H2,1-4H3/b25-12+,26-16+ |
| InChIKey | JMLCRXQCCYNATI-CVWOJKRYSA-N |
| XLogP | 5.88 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|