C22H28ClN — CID 6434983
dimethyl-[(3Z)-2-methyl-3-[(10Z)-9-tricyclo[10.4.0.03,8]hexadeca-1(12),3,5,7,10,13-hexaenylidene]propyl]azanium chloride (PubChem CID 6434983) has the molecular formula C22H28ClN and a molecular weight of 341.93 g/mol. Its IUPAC name is dimethyl-[(3Z)-2-methyl-3-[(10Z)-9-tricyclo[10.4.0.03,8]hexadeca-1(12),3,5,7,10,13-hexaenylidene]propyl]azanium chloride.
| Compound Name | dimethyl-[(3Z)-2-methyl-3-[(10Z)-9-tricyclo[10.4.0.03,8]hexadeca-1(12),3,5,7,10,13-hexaenylidene]propyl]azanium chloride |
|---|---|
| PubChem CID | 6434983 |
| Molecular Formula | C22H28ClN |
| Molecular Weight | 341.93 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | dimethyl-[(3Z)-2-methyl-3-[(10Z)-9-tricyclo[10.4.0.03,8]hexadeca-1(12),3,5,7,10,13-hexaenylidene]propyl]azanium chloride |
| SMILES | CC(/C=C1/C=C\C2=C(CCC=C2)Cc2ccccc21)C[NH+](C)C.[Cl-] |
| InChI | InChI=1S/C22H27N.ClH/c1-17(16-23(2)3)14-21-13-12-18-8-4-5-9-19(18)15-20-10-6-7-11-22(20)21;/h4,6-8,10-14,17H,5,9,15-16H2,1-3H3;1H/b13-12-,21-14-; |
| InChIKey | WSUGMWHXWQWJKX-GBRYHRIBSA-N |
| XLogP | 0.61 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.93 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |