About [2,4-dimethyl-3-[(Z)-octadec-9-enoyl]oxypentan-2-yl] (E)-nonadec-10-enoate
[2,4-dimethyl-3-[(Z)-octadec-9-enoyl]oxypentan-2-yl] (E)-nonadec-10-enoate (PubChem CID 6435041) has the molecular formula C44H82O4
and a molecular weight of 675.14 g/mol. Its IUPAC name is [2,4-dimethyl-3-[(Z)-octadec-9-enoyl]oxypentan-2-yl] (E)-nonadec-10-enoate.
Molecular Properties
| Compound Name | [2,4-dimethyl-3-[(Z)-octadec-9-enoyl]oxypentan-2-yl] (E)-nonadec-10-enoate |
| PubChem CID | 6435041 |
| Molecular Formula | C44H82O4 |
| Molecular Weight | 675.14 g/mol |
| Exact Mass | 674.62 |
| IUPAC Name | [2,4-dimethyl-3-[(Z)-octadec-9-enoyl]oxypentan-2-yl] (E)-nonadec-10-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(C(C)C)C(C)(C)OC(=O)CCCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C44H82O4/c1-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-42(46)48-44(5,6)43(40(3)4)47-41(45)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-2/h21-24,40,43H,7-20,25-39H2,1-6H3/b23-21+,24-22- |
| InChIKey | UOYWWHIVSIOWMI-CFPQKXLCSA-N |
| XLogP | 14.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 675.14 |
| LogP ≤ 5 | 14.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2,4-dimethyl-3-[(Z)-octadec-9-enoyl]oxypentan-2-yl] (E)-nonadec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,4-dimethyl-3-[(Z)-octadec-9-enoyl]oxypentan-2-yl] (E)-nonadec-10-enoate?
The IUPAC name of [2,4-dimethyl-3-[(Z)-octadec-9-enoyl]oxypentan-2-yl] (E)-nonadec-10-enoate (CID 6435041) is [2,4-dimethyl-3-[(Z)-octadec-9-enoyl]oxypentan-2-yl] (E)-nonadec-10-enoate.
What is the SMILES notation for [2,4-dimethyl-3-[(Z)-octadec-9-enoyl]oxypentan-2-yl] (E)-nonadec-10-enoate?
The canonical SMILES for [2,4-dimethyl-3-[(Z)-octadec-9-enoyl]oxypentan-2-yl] (E)-nonadec-10-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)OC(C(C)C)C(C)(C)OC(=O)CCCCCCCC/C=C/CCCCCCCC.
What is the InChIKey of [2,4-dimethyl-3-[(Z)-octadec-9-enoyl]oxypentan-2-yl] (E)-nonadec-10-enoate?
The InChIKey is UOYWWHIVSIOWMI-CFPQKXLCSA-N. The full InChI is InChI=1S/C44H82O4/c1-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-42(46)48-44(5,6)43(40(3)4)47-41(45)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-2/h21-24,40,43H,7-20,25-39H2,1-6H3/b23-21+,24-22-.
What are the key properties of [2,4-dimethyl-3-[(Z)-octadec-9-enoyl]oxypentan-2-yl] (E)-nonadec-10-enoate?
[2,4-dimethyl-3-[(Z)-octadec-9-enoyl]oxypentan-2-yl] (E)-nonadec-10-enoate has a molecular weight of 675.14 g/mol, XLogP of 14.34, 35 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-dimethyl-3-[(Z)-octadec-9-enoyl]oxypentan-2-yl] (E)-nonadec-10-enoate is sourced from PubChem (CID 6435041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).