About (E)-8-indol-1-yl-2,6-dimethyloct-7-en-2-ol
(E)-8-indol-1-yl-2,6-dimethyloct-7-en-2-ol (PubChem CID 6435060) has the molecular formula C18H25NO
and a molecular weight of 271.40 g/mol. Its IUPAC name is (E)-8-indol-1-yl-2,6-dimethyloct-7-en-2-ol.
Molecular Properties
| Compound Name | (E)-8-indol-1-yl-2,6-dimethyloct-7-en-2-ol |
| PubChem CID | 6435060 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (E)-8-indol-1-yl-2,6-dimethyloct-7-en-2-ol |
| SMILES | CC(/C=C/n1ccc2ccccc21)CCCC(C)(C)O |
| InChI | InChI=1S/C18H25NO/c1-15(7-6-12-18(2,3)20)10-13-19-14-11-16-8-4-5-9-17(16)19/h4-5,8-11,13-15,20H,6-7,12H2,1-3H3/b13-10+ |
| InChIKey | HAPNXLWNFLTTIE-JLHYYAGUSA-N |
| XLogP | 4.69 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-8-indol-1-yl-2,6-dimethyloct-7-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-8-indol-1-yl-2,6-dimethyloct-7-en-2-ol?
The IUPAC name of (E)-8-indol-1-yl-2,6-dimethyloct-7-en-2-ol (CID 6435060) is (E)-8-indol-1-yl-2,6-dimethyloct-7-en-2-ol.
What is the SMILES notation for (E)-8-indol-1-yl-2,6-dimethyloct-7-en-2-ol?
The canonical SMILES for (E)-8-indol-1-yl-2,6-dimethyloct-7-en-2-ol is CC(/C=C/n1ccc2ccccc21)CCCC(C)(C)O.
What is the InChIKey of (E)-8-indol-1-yl-2,6-dimethyloct-7-en-2-ol?
The InChIKey is HAPNXLWNFLTTIE-JLHYYAGUSA-N. The full InChI is InChI=1S/C18H25NO/c1-15(7-6-12-18(2,3)20)10-13-19-14-11-16-8-4-5-9-17(16)19/h4-5,8-11,13-15,20H,6-7,12H2,1-3H3/b13-10+.
What are the key properties of (E)-8-indol-1-yl-2,6-dimethyloct-7-en-2-ol?
(E)-8-indol-1-yl-2,6-dimethyloct-7-en-2-ol has a molecular weight of 271.40 g/mol, XLogP of 4.69, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-8-indol-1-yl-2,6-dimethyloct-7-en-2-ol is sourced from PubChem (CID 6435060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).