C22H20N4O — CID 6435281
2-[(1E,3E,5E)-6-(4-carbamimidoylphenyl)hexa-1,3,5-trienyl]-1-benzofuran-5-carboximidamide (PubChem CID 6435281) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-[(1E,3E,5E)-6-(4-carbamimidoylphenyl)hexa-1,3,5-trienyl]-1-benzofuran-5-carboximidamide.
| Compound Name | 2-[(1E,3E,5E)-6-(4-carbamimidoylphenyl)hexa-1,3,5-trienyl]-1-benzofuran-5-carboximidamide |
|---|---|
| PubChem CID | 6435281 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-[(1E,3E,5E)-6-(4-carbamimidoylphenyl)hexa-1,3,5-trienyl]-1-benzofuran-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(/C=C/C=C/C=C/c2cc3cc(/C(N)=N/[H])ccc3o2)cc1 |
| InChI | InChI=1S/C22H20N4O/c23-21(24)16-9-7-15(8-10-16)5-3-1-2-4-6-19-14-18-13-17(22(25)26)11-12-20(18)27-19/h1-14H,(H3,23,24)(H3,25,26)/b2-1+,5-3+,6-4+ |
| InChIKey | COGBMILTBQHUIU-CRQXNEITSA-N |
| XLogP | 4.28 |
| TPSA | 112.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|