About 1-S,4-S-diphenyl (Z)-but-2-enebis(thioate)
1-S,4-S-diphenyl (Z)-but-2-enebis(thioate) (PubChem CID 6435287) has the molecular formula C16H12O2S2
and a molecular weight of 300.40 g/mol. Its IUPAC name is 1-S,4-S-diphenyl (Z)-but-2-enebis(thioate).
Molecular Properties
| Compound Name | 1-S,4-S-diphenyl (Z)-but-2-enebis(thioate) |
| PubChem CID | 6435287 |
| Molecular Formula | C16H12O2S2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 1-S,4-S-diphenyl (Z)-but-2-enebis(thioate) |
| SMILES | O=C(/C=C\C(=O)Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C16H12O2S2/c17-15(19-13-7-3-1-4-8-13)11-12-16(18)20-14-9-5-2-6-10-14/h1-12H/b12-11- |
| InChIKey | DZJTZPMLSGHBGG-QXMHVHEDSA-N |
| XLogP | 4.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1-S,4-S-diphenyl (Z)-but-2-enebis(thioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-S,4-S-diphenyl (Z)-but-2-enebis(thioate)?
The IUPAC name of 1-S,4-S-diphenyl (Z)-but-2-enebis(thioate) (CID 6435287) is 1-S,4-S-diphenyl (Z)-but-2-enebis(thioate).
What is the SMILES notation for 1-S,4-S-diphenyl (Z)-but-2-enebis(thioate)?
The canonical SMILES for 1-S,4-S-diphenyl (Z)-but-2-enebis(thioate) is O=C(/C=C\C(=O)Sc1ccccc1)Sc1ccccc1.
What is the InChIKey of 1-S,4-S-diphenyl (Z)-but-2-enebis(thioate)?
The InChIKey is DZJTZPMLSGHBGG-QXMHVHEDSA-N. The full InChI is InChI=1S/C16H12O2S2/c17-15(19-13-7-3-1-4-8-13)11-12-16(18)20-14-9-5-2-6-10-14/h1-12H/b12-11-.
What are the key properties of 1-S,4-S-diphenyl (Z)-but-2-enebis(thioate)?
1-S,4-S-diphenyl (Z)-but-2-enebis(thioate) has a molecular weight of 300.40 g/mol, XLogP of 4.18, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-S,4-S-diphenyl (Z)-but-2-enebis(thioate) is sourced from PubChem (CID 6435287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).