About 1-benzyl-2,5-dihydro-1lambda5-phosphole 1-oxide
1-benzyl-2,5-dihydro-1lambda5-phosphole 1-oxide (PubChem CID 643541) has the molecular formula C11H13OP
and a molecular weight of 192.20 g/mol. Its IUPAC name is 1-benzyl-2,5-dihydro-1lambda5-phosphole 1-oxide.
Molecular Properties
| Compound Name | 1-benzyl-2,5-dihydro-1lambda5-phosphole 1-oxide |
| PubChem CID | 643541 |
| Molecular Formula | C11H13OP |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 1-benzyl-2,5-dihydro-1lambda5-phosphole 1-oxide |
| SMILES | O=P1(Cc2ccccc2)CC=CC1 |
| InChI | InChI=1S/C11H13OP/c12-13(8-4-5-9-13)10-11-6-2-1-3-7-11/h1-7H,8-10H2 |
| InChIKey | VPGIFQCEABAPFS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-2,5-dihydro-1lambda5-phosphole 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2,5-dihydro-1lambda5-phosphole 1-oxide?
The IUPAC name of 1-benzyl-2,5-dihydro-1lambda5-phosphole 1-oxide (CID 643541) is 1-benzyl-2,5-dihydro-1lambda5-phosphole 1-oxide.
What is the SMILES notation for 1-benzyl-2,5-dihydro-1lambda5-phosphole 1-oxide?
The canonical SMILES for 1-benzyl-2,5-dihydro-1lambda5-phosphole 1-oxide is O=P1(Cc2ccccc2)CC=CC1.
What is the InChIKey of 1-benzyl-2,5-dihydro-1lambda5-phosphole 1-oxide?
The InChIKey is VPGIFQCEABAPFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13OP/c12-13(8-4-5-9-13)10-11-6-2-1-3-7-11/h1-7H,8-10H2.
What are the key properties of 1-benzyl-2,5-dihydro-1lambda5-phosphole 1-oxide?
1-benzyl-2,5-dihydro-1lambda5-phosphole 1-oxide has a molecular weight of 192.20 g/mol, XLogP of 3.12, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2,5-dihydro-1lambda5-phosphole 1-oxide is sourced from PubChem (CID 643541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).