C25H31NO4 — CID 6435686
(8-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl)methyl-(2-phenylethyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate (PubChem CID 6435686) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is (8-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl)methyl-(2-phenylethyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate.
| Compound Name | (8-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl)methyl-(2-phenylethyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 6435686 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | (8-ethyl-1,2,3,4-tetrahydronaphthalen-1-yl)methyl-(2-phenylethyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate |
| SMILES | CCc1cccc2c1C(C[NH2+]CCc1ccccc1)CCC2.O=C([O-])/C=C\C(=O)O |
| InChI | InChI=1S/C21H27N.C4H4O4/c1-2-18-10-6-11-19-12-7-13-20(21(18)19)16-22-15-14-17-8-4-3-5-9-17;5-3(6)1-2-4(7)8/h3-6,8-11,20,22H,2,7,12-16H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | WCQHPCLYNKQEQL-BTJKTKAUSA-N |
| XLogP | 1.85 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|