C22H31N3O5 — CID 6435699
4-amino-N-(1-cyclohexylpyrrolidin-1-ium-3-yl)-N-methylbenzamide;(E)-4-hydroxy-4-oxobut-2-enoate (PubChem CID 6435699) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-amino-N-(1-cyclohexylpyrrolidin-1-ium-3-yl)-N-methylbenzamide;(E)-4-hydroxy-4-oxobut-2-enoate.
| Compound Name | 4-amino-N-(1-cyclohexylpyrrolidin-1-ium-3-yl)-N-methylbenzamide;(E)-4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 6435699 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 4-amino-N-(1-cyclohexylpyrrolidin-1-ium-3-yl)-N-methylbenzamide;(E)-4-hydroxy-4-oxobut-2-enoate |
| SMILES | CN(C(=O)c1ccc(N)cc1)C1CC[NH+](C2CCCCC2)C1.O=C([O-])/C=C/C(=O)O |
| InChI | InChI=1S/C18H27N3O.C4H4O4/c1-20(18(22)14-7-9-15(19)10-8-14)17-11-12-21(13-17)16-5-3-2-4-6-16;5-3(6)1-2-4(7)8/h7-10,16-17H,2-6,11-13,19H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | UUTCSRWJAKFMIJ-WLHGVMLRSA-N |
| XLogP | -0.29 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|