About 2-phenylethyl (Z)-3-phenyl-3-pyrrolidin-1-ium-1-ylprop-2-enoate chloride
2-phenylethyl (Z)-3-phenyl-3-pyrrolidin-1-ium-1-ylprop-2-enoate chloride (PubChem CID 6435779) has the molecular formula C21H24ClNO2
and a molecular weight of 357.88 g/mol. Its IUPAC name is 2-phenylethyl (Z)-3-phenyl-3-pyrrolidin-1-ium-1-ylprop-2-enoate chloride.
Molecular Properties
| Compound Name | 2-phenylethyl (Z)-3-phenyl-3-pyrrolidin-1-ium-1-ylprop-2-enoate chloride |
| PubChem CID | 6435779 |
| Molecular Formula | C21H24ClNO2 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-phenylethyl (Z)-3-phenyl-3-pyrrolidin-1-ium-1-ylprop-2-enoate chloride |
| SMILES | O=C(/C=C(/c1ccccc1)[NH+]1CCCC1)OCCc1ccccc1.[Cl-] |
| InChI | InChI=1S/C21H23NO2.ClH/c23-21(24-16-13-18-9-3-1-4-10-18)17-20(22-14-7-8-15-22)19-11-5-2-6-12-19;/h1-6,9-12,17H,7-8,13-16H2;1H/b20-17-; |
| InChIKey | DTPSRTCQTFKFMX-BZHDPTRRSA-N |
| XLogP | -0.50 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethyl (Z)-3-phenyl-3-pyrrolidin-1-ium-1-ylprop-2-enoate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl (Z)-3-phenyl-3-pyrrolidin-1-ium-1-ylprop-2-enoate chloride?
The IUPAC name of 2-phenylethyl (Z)-3-phenyl-3-pyrrolidin-1-ium-1-ylprop-2-enoate chloride (CID 6435779) is 2-phenylethyl (Z)-3-phenyl-3-pyrrolidin-1-ium-1-ylprop-2-enoate chloride.
What is the SMILES notation for 2-phenylethyl (Z)-3-phenyl-3-pyrrolidin-1-ium-1-ylprop-2-enoate chloride?
The canonical SMILES for 2-phenylethyl (Z)-3-phenyl-3-pyrrolidin-1-ium-1-ylprop-2-enoate chloride is O=C(/C=C(/c1ccccc1)[NH+]1CCCC1)OCCc1ccccc1.[Cl-].
What is the InChIKey of 2-phenylethyl (Z)-3-phenyl-3-pyrrolidin-1-ium-1-ylprop-2-enoate chloride?
The InChIKey is DTPSRTCQTFKFMX-BZHDPTRRSA-N. The full InChI is InChI=1S/C21H23NO2.ClH/c23-21(24-16-13-18-9-3-1-4-10-18)17-20(22-14-7-8-15-22)19-11-5-2-6-12-19;/h1-6,9-12,17H,7-8,13-16H2;1H/b20-17-;.
What are the key properties of 2-phenylethyl (Z)-3-phenyl-3-pyrrolidin-1-ium-1-ylprop-2-enoate chloride?
2-phenylethyl (Z)-3-phenyl-3-pyrrolidin-1-ium-1-ylprop-2-enoate chloride has a molecular weight of 357.88 g/mol, XLogP of -0.50, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl (Z)-3-phenyl-3-pyrrolidin-1-ium-1-ylprop-2-enoate chloride is sourced from PubChem (CID 6435779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).