About prop-2-enyl (2E,4E)-hexa-2,4-dienoate
prop-2-enyl (2E,4E)-hexa-2,4-dienoate (PubChem CID 6435833) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is prop-2-enyl (2E,4E)-hexa-2,4-dienoate.
Molecular Properties
| Compound Name | prop-2-enyl (2E,4E)-hexa-2,4-dienoate |
| PubChem CID | 6435833 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | prop-2-enyl (2E,4E)-hexa-2,4-dienoate |
| SMILES | C=CCOC(=O)/C=C/C=C/C |
| InChI | InChI=1S/C9H12O2/c1-3-5-6-7-9(10)11-8-4-2/h3-7H,2,8H2,1H3/b5-3+,7-6+ |
| InChIKey | CVNZYQJBZIJLCL-TWTPFVCWSA-N |
| XLogP | 1.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl (2E,4E)-hexa-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl (2E,4E)-hexa-2,4-dienoate?
The IUPAC name of prop-2-enyl (2E,4E)-hexa-2,4-dienoate (CID 6435833) is prop-2-enyl (2E,4E)-hexa-2,4-dienoate.
What is the SMILES notation for prop-2-enyl (2E,4E)-hexa-2,4-dienoate?
The canonical SMILES for prop-2-enyl (2E,4E)-hexa-2,4-dienoate is C=CCOC(=O)/C=C/C=C/C.
What is the InChIKey of prop-2-enyl (2E,4E)-hexa-2,4-dienoate?
The InChIKey is CVNZYQJBZIJLCL-TWTPFVCWSA-N. The full InChI is InChI=1S/C9H12O2/c1-3-5-6-7-9(10)11-8-4-2/h3-7H,2,8H2,1H3/b5-3+,7-6+.
What are the key properties of prop-2-enyl (2E,4E)-hexa-2,4-dienoate?
prop-2-enyl (2E,4E)-hexa-2,4-dienoate has a molecular weight of 152.19 g/mol, XLogP of 1.85, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl (2E,4E)-hexa-2,4-dienoate is sourced from PubChem (CID 6435833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).