(Z)-octadec-9-en-1-ol;phosphoric acid

C18H39O5P — CID 6435865

IUPAC(Z)-octadec-9-en-1-ol;phosphoric acid
SMILESCCCCCCCC/C=C\CCCCCCCCO.O=P(O)(O)O
InChIInChI=1S/C18H36O.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-5(2,3)4/h9-10,19H,2-8,11-18H2,1H3;(H3,1,2,3,4)/b10-9-;
InChIKeyJGVOASSDYQIBIF-KVVVOXFISA-N
MW366.48 g/mol
LogP5.09
Rot. Bonds15

About (Z)-octadec-9-en-1-ol;phosphoric acid

(Z)-octadec-9-en-1-ol;phosphoric acid (PubChem CID 6435865) has the molecular formula C18H39O5P and a molecular weight of 366.48 g/mol. Its IUPAC name is (Z)-octadec-9-en-1-ol;phosphoric acid.

Molecular Properties

Compound Name(Z)-octadec-9-en-1-ol;phosphoric acid
PubChem CID6435865
Molecular FormulaC18H39O5P
Molecular Weight366.48 g/mol
Exact Mass366.25
IUPAC Name(Z)-octadec-9-en-1-ol;phosphoric acid
SMILESCCCCCCCC/C=C\CCCCCCCCO.O=P(O)(O)O
InChIInChI=1S/C18H36O.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-5(2,3)4/h9-10,19H,2-8,11-18H2,1H3;(H3,1,2,3,4)/b10-9-;
InChIKeyJGVOASSDYQIBIF-KVVVOXFISA-N
XLogP5.09
TPSA97.99 Ų
H-Bond Donors4
H-Bond Acceptors2
Rotatable Bonds15
Heavy Atoms24
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500366.48
LogP ≤ 55.09
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (Z)-octadec-9-en-1-ol;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-octadec-9-en-1-ol;phosphoric acid?
The IUPAC name of (Z)-octadec-9-en-1-ol;phosphoric acid (CID 6435865) is (Z)-octadec-9-en-1-ol;phosphoric acid.
What is the SMILES notation for (Z)-octadec-9-en-1-ol;phosphoric acid?
The canonical SMILES for (Z)-octadec-9-en-1-ol;phosphoric acid is CCCCCCCC/C=C\CCCCCCCCO.O=P(O)(O)O.
What is the InChIKey of (Z)-octadec-9-en-1-ol;phosphoric acid?
The InChIKey is JGVOASSDYQIBIF-KVVVOXFISA-N. The full InChI is InChI=1S/C18H36O.H3O4P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;1-5(2,3)4/h9-10,19H,2-8,11-18H2,1H3;(H3,1,2,3,4)/b10-9-;.
What are the key properties of (Z)-octadec-9-en-1-ol;phosphoric acid?
(Z)-octadec-9-en-1-ol;phosphoric acid has a molecular weight of 366.48 g/mol, XLogP of 5.09, 15 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-octadec-9-en-1-ol;phosphoric acid is sourced from PubChem (CID 6435865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).