C23H28 — CID 6436116
1,1,4,4-tetramethyl-6-[(E)-1-phenylprop-1-en-2-yl]-2,3-dihydronaphthalene (PubChem CID 6436116) has the molecular formula C23H28 and a molecular weight of 304.48 g/mol. Its IUPAC name is 1,1,4,4-tetramethyl-6-[(E)-1-phenylprop-1-en-2-yl]-2,3-dihydronaphthalene.
| Compound Name | 1,1,4,4-tetramethyl-6-[(E)-1-phenylprop-1-en-2-yl]-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 6436116 |
| Molecular Formula | C23H28 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1,1,4,4-tetramethyl-6-[(E)-1-phenylprop-1-en-2-yl]-2,3-dihydronaphthalene |
| SMILES | C/C(=C\c1ccccc1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H28/c1-17(15-18-9-7-6-8-10-18)19-11-12-20-21(16-19)23(4,5)14-13-22(20,2)3/h6-12,15-16H,13-14H2,1-5H3/b17-15+ |
| InChIKey | MUJQTAMVZYFLCR-BMRADRMJSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|