About bis(3-trimethoxysilylpropyl) (Z)-but-2-enedioate
bis(3-trimethoxysilylpropyl) (Z)-but-2-enedioate (PubChem CID 6436333) has the molecular formula C16H32O10Si2
and a molecular weight of 440.59 g/mol. Its IUPAC name is bis(3-trimethoxysilylpropyl) (Z)-but-2-enedioate.
Molecular Properties
| Compound Name | bis(3-trimethoxysilylpropyl) (Z)-but-2-enedioate |
| PubChem CID | 6436333 |
| Molecular Formula | C16H32O10Si2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | bis(3-trimethoxysilylpropyl) (Z)-but-2-enedioate |
| SMILES | CO[Si](CCCOC(=O)/C=C\C(=O)OCCC[Si](OC)(OC)OC)(OC)OC |
| InChI | InChI=1S/C16H32O10Si2/c1-19-27(20-2,21-3)13-7-11-25-15(17)9-10-16(18)26-12-8-14-28(22-4,23-5)24-6/h9-10H,7-8,11-14H2,1-6H3/b10-9- |
| InChIKey | GPWPWELMLCKXRP-KTKRTIGZSA-N |
| XLogP | 1.17 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(3-trimethoxysilylpropyl) (Z)-but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-trimethoxysilylpropyl) (Z)-but-2-enedioate?
The IUPAC name of bis(3-trimethoxysilylpropyl) (Z)-but-2-enedioate (CID 6436333) is bis(3-trimethoxysilylpropyl) (Z)-but-2-enedioate.
What is the SMILES notation for bis(3-trimethoxysilylpropyl) (Z)-but-2-enedioate?
The canonical SMILES for bis(3-trimethoxysilylpropyl) (Z)-but-2-enedioate is CO[Si](CCCOC(=O)/C=C\C(=O)OCCC[Si](OC)(OC)OC)(OC)OC.
What is the InChIKey of bis(3-trimethoxysilylpropyl) (Z)-but-2-enedioate?
The InChIKey is GPWPWELMLCKXRP-KTKRTIGZSA-N. The full InChI is InChI=1S/C16H32O10Si2/c1-19-27(20-2,21-3)13-7-11-25-15(17)9-10-16(18)26-12-8-14-28(22-4,23-5)24-6/h9-10H,7-8,11-14H2,1-6H3/b10-9-.
What are the key properties of bis(3-trimethoxysilylpropyl) (Z)-but-2-enedioate?
bis(3-trimethoxysilylpropyl) (Z)-but-2-enedioate has a molecular weight of 440.59 g/mol, XLogP of 1.17, 16 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-trimethoxysilylpropyl) (Z)-but-2-enedioate is sourced from PubChem (CID 6436333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).