About [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-phenylacetate
[(2Z)-3,7-dimethylocta-2,6-dienyl] 2-phenylacetate (PubChem CID 6436374) has the molecular formula C18H24O2
and a molecular weight of 272.39 g/mol. Its IUPAC name is [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-phenylacetate.
Molecular Properties
| Compound Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-phenylacetate |
| PubChem CID | 6436374 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-phenylacetate |
| SMILES | CC(C)=CCC/C(C)=C\COC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H24O2/c1-15(2)8-7-9-16(3)12-13-20-18(19)14-17-10-5-4-6-11-17/h4-6,8,10-12H,7,9,13-14H2,1-3H3/b16-12- |
| InChIKey | UXAIJXIHZDZMSK-VBKFSLOCSA-N |
| XLogP | 4.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-phenylacetate?
The IUPAC name of [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-phenylacetate (CID 6436374) is [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-phenylacetate.
What is the SMILES notation for [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-phenylacetate?
The canonical SMILES for [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-phenylacetate is CC(C)=CCC/C(C)=C\COC(=O)Cc1ccccc1.
What is the InChIKey of [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-phenylacetate?
The InChIKey is UXAIJXIHZDZMSK-VBKFSLOCSA-N. The full InChI is InChI=1S/C18H24O2/c1-15(2)8-7-9-16(3)12-13-20-18(19)14-17-10-5-4-6-11-17/h4-6,8,10-12H,7,9,13-14H2,1-3H3/b16-12-.
What are the key properties of [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-phenylacetate?
[(2Z)-3,7-dimethylocta-2,6-dienyl] 2-phenylacetate has a molecular weight of 272.39 g/mol, XLogP of 4.47, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-3,7-dimethylocta-2,6-dienyl] 2-phenylacetate is sourced from PubChem (CID 6436374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).