About [(Z)-octadec-9-enyl] prop-2-enoate
[(Z)-octadec-9-enyl] prop-2-enoate (PubChem CID 6436391) has the molecular formula C21H38O2
and a molecular weight of 322.53 g/mol. Its IUPAC name is [(Z)-octadec-9-enyl] prop-2-enoate.
Molecular Properties
| Compound Name | [(Z)-octadec-9-enyl] prop-2-enoate |
| PubChem CID | 6436391 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.29 |
| IUPAC Name | [(Z)-octadec-9-enyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C21H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-21(22)4-2/h4,11-12H,2-3,5-10,13-20H2,1H3/b12-11- |
| InChIKey | ASAPXSLRMDUMFX-QXMHVHEDSA-N |
| XLogP | 6.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-octadec-9-enyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-octadec-9-enyl] prop-2-enoate?
The IUPAC name of [(Z)-octadec-9-enyl] prop-2-enoate (CID 6436391) is [(Z)-octadec-9-enyl] prop-2-enoate.
What is the SMILES notation for [(Z)-octadec-9-enyl] prop-2-enoate?
The canonical SMILES for [(Z)-octadec-9-enyl] prop-2-enoate is C=CC(=O)OCCCCCCCC/C=C\CCCCCCCC.
What is the InChIKey of [(Z)-octadec-9-enyl] prop-2-enoate?
The InChIKey is ASAPXSLRMDUMFX-QXMHVHEDSA-N. The full InChI is InChI=1S/C21H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-21(22)4-2/h4,11-12H,2-3,5-10,13-20H2,1H3/b12-11-.
What are the key properties of [(Z)-octadec-9-enyl] prop-2-enoate?
[(Z)-octadec-9-enyl] prop-2-enoate has a molecular weight of 322.53 g/mol, XLogP of 6.75, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-octadec-9-enyl] prop-2-enoate is sourced from PubChem (CID 6436391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).