About Butanedioic acid, 2-(dodecen-1-yl)-, mono(2-methylpropyl) ester
Butanedioic acid, 2-(dodecen-1-yl)-, mono(2-methylpropyl) ester (PubChem CID 6436451) has the molecular formula C20H36O4
and a molecular weight of 340.50 g/mol. Its IUPAC name is (E)-2-[2-(2-methylpropoxy)-2-oxoethyl]tetradec-8-enoic acid.
Molecular Properties
| Compound Name | Butanedioic acid, 2-(dodecen-1-yl)-, mono(2-methylpropyl) ester |
| PubChem CID | 6436451 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | (E)-2-[2-(2-methylpropoxy)-2-oxoethyl]tetradec-8-enoic acid |
| SMILES | CCCCC/C=C/CCCCCC(CC(=O)OCC(C)C)C(=O)O |
| InChI | InChI=1S/C20H36O4/c1-4-5-6-7-8-9-10-11-12-13-14-18(20(22)23)15-19(21)24-16-17(2)3/h8-9,17-18H,4-7,10-16H2,1-3H3,(H,22,23)/b9-8+ |
| InChIKey | CTQNIJLFRBJWKZ-CMDGGOBGSA-N |
| XLogP | 6.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | 361 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze Butanedioic acid, 2-(dodecen-1-yl)-, mono(2-methylpropyl) ester with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Butanedioic acid, 2-(dodecen-1-yl)-, mono(2-methylpropyl) ester?
The IUPAC name of Butanedioic acid, 2-(dodecen-1-yl)-, mono(2-methylpropyl) ester (CID 6436451) is (E)-2-[2-(2-methylpropoxy)-2-oxoethyl]tetradec-8-enoic acid.
What is the SMILES notation for Butanedioic acid, 2-(dodecen-1-yl)-, mono(2-methylpropyl) ester?
The canonical SMILES for Butanedioic acid, 2-(dodecen-1-yl)-, mono(2-methylpropyl) ester is CCCCC/C=C/CCCCCC(CC(=O)OCC(C)C)C(=O)O.
What is the InChIKey of Butanedioic acid, 2-(dodecen-1-yl)-, mono(2-methylpropyl) ester?
The InChIKey is CTQNIJLFRBJWKZ-CMDGGOBGSA-N. The full InChI is InChI=1S/C20H36O4/c1-4-5-6-7-8-9-10-11-12-13-14-18(20(22)23)15-19(21)24-16-17(2)3/h8-9,17-18H,4-7,10-16H2,1-3H3,(H,22,23)/b9-8+.
What are the key properties of Butanedioic acid, 2-(dodecen-1-yl)-, mono(2-methylpropyl) ester?
Butanedioic acid, 2-(dodecen-1-yl)-, mono(2-methylpropyl) ester has a molecular weight of 340.50 g/mol, XLogP of 6.30, 16 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Butanedioic acid, 2-(dodecen-1-yl)-, mono(2-methylpropyl) ester is sourced from PubChem (CID 6436451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).