C15H24O2 — CID 643652
(1R,2E,6E,10E)-3-(hydroxymethyl)-7,11-dimethylcyclododeca-2,6,10-trien-1-ol (PubChem CID 643652) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1R,2E,6E,10E)-3-(hydroxymethyl)-7,11-dimethylcyclododeca-2,6,10-trien-1-ol.
| Compound Name | (1R,2E,6E,10E)-3-(hydroxymethyl)-7,11-dimethylcyclododeca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 643652 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1R,2E,6E,10E)-3-(hydroxymethyl)-7,11-dimethylcyclododeca-2,6,10-trien-1-ol |
| SMILES | C/C1=C\CC/C(CO)=C\[C@H](O)C/C(C)=C/CC1 |
| InChI | InChI=1S/C15H24O2/c1-12-5-3-7-13(2)9-15(17)10-14(11-16)8-4-6-12/h6-7,10,15-17H,3-5,8-9,11H2,1-2H3/b12-6+,13-7+,14-10+/t15-/m1/s1 |
| InChIKey | RCJTUBLQPQRESN-FJOWFKQPSA-N |
| XLogP | 3.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|