C33H40O10 — CID 643655
[(1S,2R,3aR,5S,6E,10R,13R,13aR)-3a,10,13-triacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-1,2,3,5,10,11,13,13a-octahydrocyclopenta[12]annulen-1-yl] benzoate (PubChem CID 643655) has the molecular formula C33H40O10 and a molecular weight of 596.67 g/mol. Its IUPAC name is [(1S,2R,3aR,5S,6E,10R,13R,13aR)-3a,10,13-triacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-1,2,3,5,10,11,13,13a-octahydrocyclopenta[12]annulen-1-yl] benzoate.
| Compound Name | [(1S,2R,3aR,5S,6E,10R,13R,13aR)-3a,10,13-triacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-1,2,3,5,10,11,13,13a-octahydrocyclopenta[12]annulen-1-yl] benzoate |
|---|---|
| PubChem CID | 643655 |
| Molecular Formula | C33H40O10 |
| Molecular Weight | 596.67 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | [(1S,2R,3aR,5S,6E,10R,13R,13aR)-3a,10,13-triacetyloxy-2,5,8,8-tetramethyl-12-methylidene-4,9-dioxo-1,2,3,5,10,11,13,13a-octahydrocyclopenta[12]annulen-1-yl] benzoate |
| SMILES | C=C1C[C@@H](OC(C)=O)C(=O)C(C)(C)/C=C/[C@H](C)C(=O)[C@@]2(OC(C)=O)C[C@@H](C)[C@H](OC(=O)c3ccccc3)[C@@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C33H40O10/c1-18-14-15-32(7,8)30(38)25(40-21(4)34)16-19(2)27(41-22(5)35)26-28(42-31(39)24-12-10-9-11-13-24)20(3)17-33(26,29(18)37)43-23(6)36/h9-15,18,20,25-28H,2,16-17H2,1,3-8H3/b15-14+/t18-,20+,25+,26-,27-,28-,33+/m0/s1 |
| InChIKey | UXXCYRXOIGPLCA-PNURPOIQSA-N |
| XLogP | 4.35 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|