C14H23N — CID 6436709
(4E)-2,2,5,9-tetramethyldeca-4,8-dienenitrile (PubChem CID 6436709) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (4E)-2,2,5,9-tetramethyldeca-4,8-dienenitrile.
| Compound Name | (4E)-2,2,5,9-tetramethyldeca-4,8-dienenitrile |
|---|---|
| PubChem CID | 6436709 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (4E)-2,2,5,9-tetramethyldeca-4,8-dienenitrile |
| SMILES | CC(C)=CCC/C(C)=C/CC(C)(C)C#N |
| InChI | InChI=1S/C14H23N/c1-12(2)7-6-8-13(3)9-10-14(4,5)11-15/h7,9H,6,8,10H2,1-5H3/b13-9+ |
| InChIKey | NFMTVOFPAPETFY-UKTHLTGXSA-N |
| XLogP | 4.62 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|