C29H48O4 — CID 6436802
2,3-dimethoxy-5-methyl-6-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 6436802) has the molecular formula C29H48O4 and a molecular weight of 460.70 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dimethoxy-5-methyl-6-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 6436802 |
| Molecular Formula | C29H48O4 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-[(E,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=C(OC)C(=O)C(C/C=C(\C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)=C(C)C1=O |
| InChI | InChI=1S/C29H48O4/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-17-23(5)18-19-25-24(6)26(30)28(32-7)29(33-8)27(25)31/h18,20-22H,9-17,19H2,1-8H3/b23-18+/t21-,22-/m1/s1 |
| InChIKey | KMBWCXAUPFWDKK-MRIFWDATSA-N |
| XLogP | 7.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|