About 2-sulfanylethyl (Z)-octadec-9-enoate
2-sulfanylethyl (Z)-octadec-9-enoate (PubChem CID 6436848) has the molecular formula C20H38O2S
and a molecular weight of 342.59 g/mol. Its IUPAC name is 2-sulfanylethyl (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | 2-sulfanylethyl (Z)-octadec-9-enoate |
| PubChem CID | 6436848 |
| Molecular Formula | C20H38O2S |
| Molecular Weight | 342.59 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 2-sulfanylethyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCS |
| InChI | InChI=1S/C20H38O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(21)22-18-19-23/h9-10,23H,2-8,11-19H2,1H3/b10-9- |
| InChIKey | WEMJWKKJHSZRQT-KTKRTIGZSA-N |
| XLogP | 6.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.59 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylethyl (Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylethyl (Z)-octadec-9-enoate?
The IUPAC name of 2-sulfanylethyl (Z)-octadec-9-enoate (CID 6436848) is 2-sulfanylethyl (Z)-octadec-9-enoate.
What is the SMILES notation for 2-sulfanylethyl (Z)-octadec-9-enoate?
The canonical SMILES for 2-sulfanylethyl (Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)OCCS.
What is the InChIKey of 2-sulfanylethyl (Z)-octadec-9-enoate?
The InChIKey is WEMJWKKJHSZRQT-KTKRTIGZSA-N. The full InChI is InChI=1S/C20H38O2S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(21)22-18-19-23/h9-10,23H,2-8,11-19H2,1H3/b10-9-.
What are the key properties of 2-sulfanylethyl (Z)-octadec-9-enoate?
2-sulfanylethyl (Z)-octadec-9-enoate has a molecular weight of 342.59 g/mol, XLogP of 6.50, 17 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylethyl (Z)-octadec-9-enoate is sourced from PubChem (CID 6436848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).