C22H32O5 — CID 643686
[(2S,3R,3aR,4S,5R,7aR)-3-acetyl-5-acetyloxy-7-methylidene-4-propan-2-yl-1,2,3,3a,4,5,6,7a-octahydroinden-2-yl] (Z)-2-methylbut-2-enoate (PubChem CID 643686) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is [(2S,3R,3aR,4S,5R,7aR)-3-acetyl-5-acetyloxy-7-methylidene-4-propan-2-yl-1,2,3,3a,4,5,6,7a-octahydroinden-2-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(2S,3R,3aR,4S,5R,7aR)-3-acetyl-5-acetyloxy-7-methylidene-4-propan-2-yl-1,2,3,3a,4,5,6,7a-octahydroinden-2-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 643686 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [(2S,3R,3aR,4S,5R,7aR)-3-acetyl-5-acetyloxy-7-methylidene-4-propan-2-yl-1,2,3,3a,4,5,6,7a-octahydroinden-2-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C1C[C@@H](OC(C)=O)[C@@H](C(C)C)[C@@H]2[C@@H](C(C)=O)[C@@H](OC(=O)/C(C)=C\C)C[C@@H]12 |
| InChI | InChI=1S/C22H32O5/c1-8-12(4)22(25)27-18-10-16-13(5)9-17(26-15(7)24)19(11(2)3)21(16)20(18)14(6)23/h8,11,16-21H,5,9-10H2,1-4,6-7H3/b12-8-/t16-,17+,18-,19+,20-,21+/m0/s1 |
| InChIKey | FDFXUUAZUMJPNJ-OZWCXVTBSA-N |
| XLogP | 3.87 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|