C24H47NO2 — CID 6436959
1-[2-hydroxypropyl-[(7E,11E)-octadeca-7,11-dienyl]amino]propan-2-ol (PubChem CID 6436959) has the molecular formula C24H47NO2 and a molecular weight of 381.65 g/mol. Its IUPAC name is 1-[2-hydroxypropyl-[(7E,11E)-octadeca-7,11-dienyl]amino]propan-2-ol.
| Compound Name | 1-[2-hydroxypropyl-[(7E,11E)-octadeca-7,11-dienyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 6436959 |
| Molecular Formula | C24H47NO2 |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 381.36 |
| IUPAC Name | 1-[2-hydroxypropyl-[(7E,11E)-octadeca-7,11-dienyl]amino]propan-2-ol |
| SMILES | CCCCCC/C=C/CC/C=C/CCCCCCN(CC(C)O)CC(C)O |
| InChI | InChI=1S/C24H47NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25(21-23(2)26)22-24(3)27/h9-10,13-14,23-24,26-27H,4-8,11-12,15-22H2,1-3H3/b10-9+,14-13+ |
| InChIKey | ILWGQRCFIKROEO-LBSPPQMYSA-N |
| XLogP | 5.86 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|