About 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetaldehyde
2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetaldehyde (PubChem CID 6436989) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetaldehyde.
Molecular Properties
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetaldehyde |
| PubChem CID | 6436989 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetaldehyde |
| SMILES | CC(C)=CCC/C(C)=C/COCC=O |
| InChI | InChI=1S/C12H20O2/c1-11(2)5-4-6-12(3)7-9-14-10-8-13/h5,7-8H,4,6,9-10H2,1-3H3/b12-7+ |
| InChIKey | LAUVMIDRJMQUQL-KPKJPENVSA-N |
| XLogP | 2.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetaldehyde?
The IUPAC name of 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetaldehyde (CID 6436989) is 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetaldehyde.
What is the SMILES notation for 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetaldehyde?
The canonical SMILES for 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetaldehyde is CC(C)=CCC/C(C)=C/COCC=O.
What is the InChIKey of 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetaldehyde?
The InChIKey is LAUVMIDRJMQUQL-KPKJPENVSA-N. The full InChI is InChI=1S/C12H20O2/c1-11(2)5-4-6-12(3)7-9-14-10-8-13/h5,7-8H,4,6,9-10H2,1-3H3/b12-7+.
What are the key properties of 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetaldehyde?
2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetaldehyde has a molecular weight of 196.29 g/mol, XLogP of 2.89, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E)-3,7-dimethylocta-2,6-dienoxy]acetaldehyde is sourced from PubChem (CID 6436989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).