About 2-[(E)-3-ethoxybut-1-enyl]-1,3,3-trimethylcyclohexene
2-[(E)-3-ethoxybut-1-enyl]-1,3,3-trimethylcyclohexene (PubChem CID 6436993) has the molecular formula C15H26O
and a molecular weight of 222.37 g/mol. Its IUPAC name is 2-[(E)-3-ethoxybut-1-enyl]-1,3,3-trimethylcyclohexene.
Molecular Properties
| Compound Name | 2-[(E)-3-ethoxybut-1-enyl]-1,3,3-trimethylcyclohexene |
| PubChem CID | 6436993 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 2-[(E)-3-ethoxybut-1-enyl]-1,3,3-trimethylcyclohexene |
| SMILES | CCOC(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C15H26O/c1-6-16-13(3)9-10-14-12(2)8-7-11-15(14,4)5/h9-10,13H,6-8,11H2,1-5H3/b10-9+ |
| InChIKey | BLSRPKXPUSFJDP-MDZDMXLPSA-N |
| XLogP | 4.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(E)-3-ethoxybut-1-enyl]-1,3,3-trimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-3-ethoxybut-1-enyl]-1,3,3-trimethylcyclohexene?
The IUPAC name of 2-[(E)-3-ethoxybut-1-enyl]-1,3,3-trimethylcyclohexene (CID 6436993) is 2-[(E)-3-ethoxybut-1-enyl]-1,3,3-trimethylcyclohexene.
What is the SMILES notation for 2-[(E)-3-ethoxybut-1-enyl]-1,3,3-trimethylcyclohexene?
The canonical SMILES for 2-[(E)-3-ethoxybut-1-enyl]-1,3,3-trimethylcyclohexene is CCOC(C)/C=C/C1=C(C)CCCC1(C)C.
What is the InChIKey of 2-[(E)-3-ethoxybut-1-enyl]-1,3,3-trimethylcyclohexene?
The InChIKey is BLSRPKXPUSFJDP-MDZDMXLPSA-N. The full InChI is InChI=1S/C15H26O/c1-6-16-13(3)9-10-14-12(2)8-7-11-15(14,4)5/h9-10,13H,6-8,11H2,1-5H3/b10-9+.
What are the key properties of 2-[(E)-3-ethoxybut-1-enyl]-1,3,3-trimethylcyclohexene?
2-[(E)-3-ethoxybut-1-enyl]-1,3,3-trimethylcyclohexene has a molecular weight of 222.37 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-3-ethoxybut-1-enyl]-1,3,3-trimethylcyclohexene is sourced from PubChem (CID 6436993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).