About [(Z)-octadec-9-enyl] 3-methylbutanoate
[(Z)-octadec-9-enyl] 3-methylbutanoate (PubChem CID 6437025) has the molecular formula C23H44O2
and a molecular weight of 352.60 g/mol. Its IUPAC name is [(Z)-octadec-9-enyl] 3-methylbutanoate.
Molecular Properties
| Compound Name | [(Z)-octadec-9-enyl] 3-methylbutanoate |
| PubChem CID | 6437025 |
| Molecular Formula | C23H44O2 |
| Molecular Weight | 352.60 g/mol |
| Exact Mass | 352.33 |
| IUPAC Name | [(Z)-octadec-9-enyl] 3-methylbutanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(=O)CC(C)C |
| InChI | InChI=1S/C23H44O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-23(24)21-22(2)3/h11-12,22H,4-10,13-21H2,1-3H3/b12-11- |
| InChIKey | LOCNAPVACGRDIV-QXMHVHEDSA-N |
| XLogP | 7.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.60 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-octadec-9-enyl] 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-octadec-9-enyl] 3-methylbutanoate?
The IUPAC name of [(Z)-octadec-9-enyl] 3-methylbutanoate (CID 6437025) is [(Z)-octadec-9-enyl] 3-methylbutanoate.
What is the SMILES notation for [(Z)-octadec-9-enyl] 3-methylbutanoate?
The canonical SMILES for [(Z)-octadec-9-enyl] 3-methylbutanoate is CCCCCCCC/C=C\CCCCCCCCOC(=O)CC(C)C.
What is the InChIKey of [(Z)-octadec-9-enyl] 3-methylbutanoate?
The InChIKey is LOCNAPVACGRDIV-QXMHVHEDSA-N. The full InChI is InChI=1S/C23H44O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-23(24)21-22(2)3/h11-12,22H,4-10,13-21H2,1-3H3/b12-11-.
What are the key properties of [(Z)-octadec-9-enyl] 3-methylbutanoate?
[(Z)-octadec-9-enyl] 3-methylbutanoate has a molecular weight of 352.60 g/mol, XLogP of 7.61, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-octadec-9-enyl] 3-methylbutanoate is sourced from PubChem (CID 6437025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).