C13H24O2 — CID 6437114
(2E,6E)-1,1-diethoxynona-2,6-diene (PubChem CID 6437114) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (2E,6E)-1,1-diethoxynona-2,6-diene.
| Compound Name | (2E,6E)-1,1-diethoxynona-2,6-diene |
|---|---|
| PubChem CID | 6437114 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (2E,6E)-1,1-diethoxynona-2,6-diene |
| SMILES | CC/C=C/CC/C=C/C(OCC)OCC |
| InChI | InChI=1S/C13H24O2/c1-4-7-8-9-10-11-12-13(14-5-2)15-6-3/h7-8,11-13H,4-6,9-10H2,1-3H3/b8-7+,12-11+ |
| InChIKey | GCIRJCKOUVCUBZ-NJHWEWLZSA-N |
| XLogP | 3.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|