About 1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole
1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole (PubChem CID 6437147) has the molecular formula C18H23N
and a molecular weight of 253.39 g/mol. Its IUPAC name is 1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole.
Molecular Properties
| Compound Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole |
| PubChem CID | 6437147 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole |
| SMILES | CC(C)=CCC/C(C)=C/Cn1ccc2ccccc21 |
| InChI | InChI=1S/C18H23N/c1-15(2)7-6-8-16(3)11-13-19-14-12-17-9-4-5-10-18(17)19/h4-5,7,9-12,14H,6,8,13H2,1-3H3/b16-11+ |
| InChIKey | BRAYSEBRLMYPDQ-LFIBNONCSA-N |
| XLogP | 5.33 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole?
The IUPAC name of 1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole (CID 6437147) is 1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole.
What is the SMILES notation for 1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole?
The canonical SMILES for 1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole is CC(C)=CCC/C(C)=C/Cn1ccc2ccccc21.
What is the InChIKey of 1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole?
The InChIKey is BRAYSEBRLMYPDQ-LFIBNONCSA-N. The full InChI is InChI=1S/C18H23N/c1-15(2)7-6-8-16(3)11-13-19-14-12-17-9-4-5-10-18(17)19/h4-5,7,9-12,14H,6,8,13H2,1-3H3/b16-11+.
What are the key properties of 1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole?
1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole has a molecular weight of 253.39 g/mol, XLogP of 5.33, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E)-3,7-dimethylocta-2,6-dienyl]indole is sourced from PubChem (CID 6437147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).