C28H60NO5P — CID 6437190
2-(dibutylamino)ethanol;[(Z)-octadec-9-enyl] dihydrogen phosphate (PubChem CID 6437190) has the molecular formula C28H60NO5P and a molecular weight of 521.76 g/mol. Its IUPAC name is 2-(dibutylamino)ethanol;[(Z)-octadec-9-enyl] dihydrogen phosphate.
| Compound Name | 2-(dibutylamino)ethanol;[(Z)-octadec-9-enyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 6437190 |
| Molecular Formula | C28H60NO5P |
| Molecular Weight | 521.76 g/mol |
| Exact Mass | 521.42 |
| IUPAC Name | 2-(dibutylamino)ethanol;[(Z)-octadec-9-enyl] dihydrogen phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOP(=O)(O)O.CCCCN(CCO)CCCC |
| InChI | InChI=1S/C18H37O4P.C10H23NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-23(19,20)21;1-3-5-7-11(9-10-12)8-6-4-2/h9-10H,2-8,11-18H2,1H3,(H2,19,20,21);12H,3-10H2,1-2H3/b10-9-; |
| InChIKey | QQAUPQIMUBFZHM-KVVVOXFISA-N |
| XLogP | 8.01 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.76 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|