C14H26O4 — CID 6437313
(2E,4E)-1,1,6,6-tetraethoxyhexa-2,4-diene (PubChem CID 6437313) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is (2E,4E)-1,1,6,6-tetraethoxyhexa-2,4-diene.
| Compound Name | (2E,4E)-1,1,6,6-tetraethoxyhexa-2,4-diene |
|---|---|
| PubChem CID | 6437313 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (2E,4E)-1,1,6,6-tetraethoxyhexa-2,4-diene |
| SMILES | CCOC(/C=C/C=C/C(OCC)OCC)OCC |
| InChI | InChI=1S/C14H26O4/c1-5-15-13(16-6-2)11-9-10-12-14(17-7-3)18-8-4/h9-14H,5-8H2,1-4H3/b11-9+,12-10+ |
| InChIKey | ACPZXXNPYPSAKR-WGDLNXRISA-N |
| XLogP | 2.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|