C44H50N2O2 — CID 6437340
5-(2,4,4-trimethylpentan-2-yl)-2-[4-[(E)-2-[4-[5-(2,4,4-trimethylpentan-2-yl)-1,3-benzoxazol-2-yl]phenyl]ethenyl]phenyl]-1,3-benzoxazole (PubChem CID 6437340) has the molecular formula C44H50N2O2 and a molecular weight of 638.90 g/mol. Its IUPAC name is 5-(2,4,4-trimethylpentan-2-yl)-2-[4-[(E)-2-[4-[5-(2,4,4-trimethylpentan-2-yl)-1,3-benzoxazol-2-yl]phenyl]ethenyl]phenyl]-1,3-benzoxazole.
| Compound Name | 5-(2,4,4-trimethylpentan-2-yl)-2-[4-[(E)-2-[4-[5-(2,4,4-trimethylpentan-2-yl)-1,3-benzoxazol-2-yl]phenyl]ethenyl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 6437340 |
| Molecular Formula | C44H50N2O2 |
| Molecular Weight | 638.90 g/mol |
| Exact Mass | 638.39 |
| IUPAC Name | 5-(2,4,4-trimethylpentan-2-yl)-2-[4-[(E)-2-[4-[5-(2,4,4-trimethylpentan-2-yl)-1,3-benzoxazol-2-yl]phenyl]ethenyl]phenyl]-1,3-benzoxazole |
| SMILES | CC(C)(C)CC(C)(C)c1ccc2oc(-c3ccc(/C=C/c4ccc(-c5nc6cc(C(C)(C)CC(C)(C)C)ccc6o5)cc4)cc3)nc2c1 |
| InChI | InChI=1S/C44H50N2O2/c1-41(2,3)27-43(7,8)33-21-23-37-35(25-33)45-39(47-37)31-17-13-29(14-18-31)11-12-30-15-19-32(20-16-30)40-46-36-26-34(22-24-38(36)48-40)44(9,10)28-42(4,5)6/h11-26H,27-28H2,1-10H3/b12-11+ |
| InChIKey | ORAOYEJFZNXENT-VAWYXSNFSA-N |
| XLogP | 12.90 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.90 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|