C22H39NO3 — CID 6437408
(9Z,12Z,15Z)-N,N-bis(2-hydroxyethyl)octadeca-9,12,15-trienamide (PubChem CID 6437408) has the molecular formula C22H39NO3 and a molecular weight of 365.56 g/mol. Its IUPAC name is (9Z,12Z,15Z)-N,N-bis(2-hydroxyethyl)octadeca-9,12,15-trienamide.
| Compound Name | (9Z,12Z,15Z)-N,N-bis(2-hydroxyethyl)octadeca-9,12,15-trienamide |
|---|---|
| PubChem CID | 6437408 |
| Molecular Formula | C22H39NO3 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.29 |
| IUPAC Name | (9Z,12Z,15Z)-N,N-bis(2-hydroxyethyl)octadeca-9,12,15-trienamide |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)N(CCO)CCO |
| InChI | InChI=1S/C22H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(26)23(18-20-24)19-21-25/h3-4,6-7,9-10,24-25H,2,5,8,11-21H2,1H3/b4-3-,7-6-,10-9- |
| InChIKey | VHFVFDNVBQGNQX-PDBXOOCHSA-N |
| XLogP | 4.39 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|