About 2-methylprop-2-enyl (Z)-2-methylbut-2-enoate
2-methylprop-2-enyl (Z)-2-methylbut-2-enoate (PubChem CID 6437425) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-methylprop-2-enyl (Z)-2-methylbut-2-enoate.
Molecular Properties
| Compound Name | 2-methylprop-2-enyl (Z)-2-methylbut-2-enoate |
| PubChem CID | 6437425 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 2-methylprop-2-enyl (Z)-2-methylbut-2-enoate |
| SMILES | C=C(C)COC(=O)/C(C)=C\C |
| InChI | InChI=1S/C9H14O2/c1-5-8(4)9(10)11-6-7(2)3/h5H,2,6H2,1,3-4H3/b8-5- |
| InChIKey | PNRCWIZNCBKLMH-YVMONPNESA-N |
| XLogP | 2.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enyl (Z)-2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enyl (Z)-2-methylbut-2-enoate?
The IUPAC name of 2-methylprop-2-enyl (Z)-2-methylbut-2-enoate (CID 6437425) is 2-methylprop-2-enyl (Z)-2-methylbut-2-enoate.
What is the SMILES notation for 2-methylprop-2-enyl (Z)-2-methylbut-2-enoate?
The canonical SMILES for 2-methylprop-2-enyl (Z)-2-methylbut-2-enoate is C=C(C)COC(=O)/C(C)=C\C.
What is the InChIKey of 2-methylprop-2-enyl (Z)-2-methylbut-2-enoate?
The InChIKey is PNRCWIZNCBKLMH-YVMONPNESA-N. The full InChI is InChI=1S/C9H14O2/c1-5-8(4)9(10)11-6-7(2)3/h5H,2,6H2,1,3-4H3/b8-5-.
What are the key properties of 2-methylprop-2-enyl (Z)-2-methylbut-2-enoate?
2-methylprop-2-enyl (Z)-2-methylbut-2-enoate has a molecular weight of 154.21 g/mol, XLogP of 2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enyl (Z)-2-methylbut-2-enoate is sourced from PubChem (CID 6437425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).