About (E)-10-hydroxy-3,6,10-trimethylundec-3-en-2-one
(E)-10-hydroxy-3,6,10-trimethylundec-3-en-2-one (PubChem CID 6437436) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is (E)-10-hydroxy-3,6,10-trimethylundec-3-en-2-one.
Molecular Properties
| Compound Name | (E)-10-hydroxy-3,6,10-trimethylundec-3-en-2-one |
| PubChem CID | 6437436 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | (E)-10-hydroxy-3,6,10-trimethylundec-3-en-2-one |
| SMILES | CC(=O)/C(C)=C/CC(C)CCCC(C)(C)O |
| InChI | InChI=1S/C14H26O2/c1-11(7-6-10-14(4,5)16)8-9-12(2)13(3)15/h9,11,16H,6-8,10H2,1-5H3/b12-9+ |
| InChIKey | ZYZZYMDGACMDKZ-FMIVXFBMSA-N |
| XLogP | 3.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-10-hydroxy-3,6,10-trimethylundec-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-10-hydroxy-3,6,10-trimethylundec-3-en-2-one?
The IUPAC name of (E)-10-hydroxy-3,6,10-trimethylundec-3-en-2-one (CID 6437436) is (E)-10-hydroxy-3,6,10-trimethylundec-3-en-2-one.
What is the SMILES notation for (E)-10-hydroxy-3,6,10-trimethylundec-3-en-2-one?
The canonical SMILES for (E)-10-hydroxy-3,6,10-trimethylundec-3-en-2-one is CC(=O)/C(C)=C/CC(C)CCCC(C)(C)O.
What is the InChIKey of (E)-10-hydroxy-3,6,10-trimethylundec-3-en-2-one?
The InChIKey is ZYZZYMDGACMDKZ-FMIVXFBMSA-N. The full InChI is InChI=1S/C14H26O2/c1-11(7-6-10-14(4,5)16)8-9-12(2)13(3)15/h9,11,16H,6-8,10H2,1-5H3/b12-9+.
What are the key properties of (E)-10-hydroxy-3,6,10-trimethylundec-3-en-2-one?
(E)-10-hydroxy-3,6,10-trimethylundec-3-en-2-one has a molecular weight of 226.36 g/mol, XLogP of 3.49, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-10-hydroxy-3,6,10-trimethylundec-3-en-2-one is sourced from PubChem (CID 6437436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).