C16H28O2 — CID 6437441
2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-4,4,6-trimethyl-1,3-dioxane (PubChem CID 6437441) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-4,4,6-trimethyl-1,3-dioxane.
| Compound Name | 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-4,4,6-trimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 6437441 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-4,4,6-trimethyl-1,3-dioxane |
| SMILES | CC(C)=CCC/C(C)=C/C1OC(C)CC(C)(C)O1 |
| InChI | InChI=1S/C16H28O2/c1-12(2)8-7-9-13(3)10-15-17-14(4)11-16(5,6)18-15/h8,10,14-15H,7,9,11H2,1-6H3/b13-10+ |
| InChIKey | GBKILRGXNOCUTQ-JLHYYAGUSA-N |
| XLogP | 4.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|