About 2-ethylhexan-1-amine;(Z)-octadec-9-enoic acid
2-ethylhexan-1-amine;(Z)-octadec-9-enoic acid (PubChem CID 6437463) has the molecular formula C26H53NO2
and a molecular weight of 411.72 g/mol. Its IUPAC name is 2-ethylhexan-1-amine;(Z)-octadec-9-enoic acid.
Molecular Properties
| Compound Name | 2-ethylhexan-1-amine;(Z)-octadec-9-enoic acid |
| PubChem CID | 6437463 |
| Molecular Formula | C26H53NO2 |
| Molecular Weight | 411.72 g/mol |
| Exact Mass | 411.41 |
| IUPAC Name | 2-ethylhexan-1-amine;(Z)-octadec-9-enoic acid |
| SMILES | CCCCC(CC)CN.CCCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2.C8H19N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-5-6-8(4-2)7-9/h9-10H,2-8,11-17H2,1H3,(H,19,20);8H,3-7,9H2,1-2H3/b10-9-; |
| InChIKey | ODELEHQHGADZBE-KVVVOXFISA-N |
| XLogP | 8.27 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.72 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexan-1-amine;(Z)-octadec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexan-1-amine;(Z)-octadec-9-enoic acid?
The IUPAC name of 2-ethylhexan-1-amine;(Z)-octadec-9-enoic acid (CID 6437463) is 2-ethylhexan-1-amine;(Z)-octadec-9-enoic acid.
What is the SMILES notation for 2-ethylhexan-1-amine;(Z)-octadec-9-enoic acid?
The canonical SMILES for 2-ethylhexan-1-amine;(Z)-octadec-9-enoic acid is CCCCC(CC)CN.CCCCCCCC/C=C\CCCCCCCC(=O)O.
What is the InChIKey of 2-ethylhexan-1-amine;(Z)-octadec-9-enoic acid?
The InChIKey is ODELEHQHGADZBE-KVVVOXFISA-N. The full InChI is InChI=1S/C18H34O2.C8H19N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-5-6-8(4-2)7-9/h9-10H,2-8,11-17H2,1H3,(H,19,20);8H,3-7,9H2,1-2H3/b10-9-;.
What are the key properties of 2-ethylhexan-1-amine;(Z)-octadec-9-enoic acid?
2-ethylhexan-1-amine;(Z)-octadec-9-enoic acid has a molecular weight of 411.72 g/mol, XLogP of 8.27, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexan-1-amine;(Z)-octadec-9-enoic acid is sourced from PubChem (CID 6437463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).