About (E,4Z)-4-(3,7-dimethyloctylidene)-3-methylpent-2-enedioic acid
(E,4Z)-4-(3,7-dimethyloctylidene)-3-methylpent-2-enedioic acid (PubChem CID 6437466) has the molecular formula C16H26O4
and a molecular weight of 282.38 g/mol. Its IUPAC name is (E,4Z)-4-(3,7-dimethyloctylidene)-3-methylpent-2-enedioic acid.
Molecular Properties
| Compound Name | (E,4Z)-4-(3,7-dimethyloctylidene)-3-methylpent-2-enedioic acid |
| PubChem CID | 6437466 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (E,4Z)-4-(3,7-dimethyloctylidene)-3-methylpent-2-enedioic acid |
| SMILES | CC(=C\C(=O)O)/C(=C/CC(C)CCCC(C)C)C(=O)O |
| InChI | InChI=1S/C16H26O4/c1-11(2)6-5-7-12(3)8-9-14(16(19)20)13(4)10-15(17)18/h9-12H,5-8H2,1-4H3,(H,17,18)(H,19,20)/b13-10+,14-9- |
| InChIKey | AFAUEBFIKITXQG-RWNVEXOMSA-N |
| XLogP | 3.88 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (E,4Z)-4-(3,7-dimethyloctylidene)-3-methylpent-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,4Z)-4-(3,7-dimethyloctylidene)-3-methylpent-2-enedioic acid?
The IUPAC name of (E,4Z)-4-(3,7-dimethyloctylidene)-3-methylpent-2-enedioic acid (CID 6437466) is (E,4Z)-4-(3,7-dimethyloctylidene)-3-methylpent-2-enedioic acid.
What is the SMILES notation for (E,4Z)-4-(3,7-dimethyloctylidene)-3-methylpent-2-enedioic acid?
The canonical SMILES for (E,4Z)-4-(3,7-dimethyloctylidene)-3-methylpent-2-enedioic acid is CC(=C\C(=O)O)/C(=C/CC(C)CCCC(C)C)C(=O)O.
What is the InChIKey of (E,4Z)-4-(3,7-dimethyloctylidene)-3-methylpent-2-enedioic acid?
The InChIKey is AFAUEBFIKITXQG-RWNVEXOMSA-N. The full InChI is InChI=1S/C16H26O4/c1-11(2)6-5-7-12(3)8-9-14(16(19)20)13(4)10-15(17)18/h9-12H,5-8H2,1-4H3,(H,17,18)(H,19,20)/b13-10+,14-9-.
What are the key properties of (E,4Z)-4-(3,7-dimethyloctylidene)-3-methylpent-2-enedioic acid?
(E,4Z)-4-(3,7-dimethyloctylidene)-3-methylpent-2-enedioic acid has a molecular weight of 282.38 g/mol, XLogP of 3.88, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E,4Z)-4-(3,7-dimethyloctylidene)-3-methylpent-2-enedioic acid is sourced from PubChem (CID 6437466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).