About acetic acid;(Z)-N-[2-(2-hydroxyethylamino)ethyl]octadec-9-enamide
acetic acid;(Z)-N-[2-(2-hydroxyethylamino)ethyl]octadec-9-enamide (PubChem CID 6437526) has the molecular formula C24H48N2O4
and a molecular weight of 428.66 g/mol. Its IUPAC name is acetic acid;(Z)-N-[2-(2-hydroxyethylamino)ethyl]octadec-9-enamide.
Molecular Properties
| Compound Name | acetic acid;(Z)-N-[2-(2-hydroxyethylamino)ethyl]octadec-9-enamide |
| PubChem CID | 6437526 |
| Molecular Formula | C24H48N2O4 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.36 |
| IUPAC Name | acetic acid;(Z)-N-[2-(2-hydroxyethylamino)ethyl]octadec-9-enamide |
| SMILES | CC(=O)O.CCCCCCCC/C=C\CCCCCCCC(=O)NCCNCCO |
| InChI | InChI=1S/C22H44N2O2.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(26)24-19-18-23-20-21-25;1-2(3)4/h9-10,23,25H,2-8,11-21H2,1H3,(H,24,26);1H3,(H,3,4)/b10-9-; |
| InChIKey | JRYIVRMKRNIHLE-KVVVOXFISA-N |
| XLogP | 4.81 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;(Z)-N-[2-(2-hydroxyethylamino)ethyl]octadec-9-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(Z)-N-[2-(2-hydroxyethylamino)ethyl]octadec-9-enamide?
The IUPAC name of acetic acid;(Z)-N-[2-(2-hydroxyethylamino)ethyl]octadec-9-enamide (CID 6437526) is acetic acid;(Z)-N-[2-(2-hydroxyethylamino)ethyl]octadec-9-enamide.
What is the SMILES notation for acetic acid;(Z)-N-[2-(2-hydroxyethylamino)ethyl]octadec-9-enamide?
The canonical SMILES for acetic acid;(Z)-N-[2-(2-hydroxyethylamino)ethyl]octadec-9-enamide is CC(=O)O.CCCCCCCC/C=C\CCCCCCCC(=O)NCCNCCO.
What is the InChIKey of acetic acid;(Z)-N-[2-(2-hydroxyethylamino)ethyl]octadec-9-enamide?
The InChIKey is JRYIVRMKRNIHLE-KVVVOXFISA-N. The full InChI is InChI=1S/C22H44N2O2.C2H4O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(26)24-19-18-23-20-21-25;1-2(3)4/h9-10,23,25H,2-8,11-21H2,1H3,(H,24,26);1H3,(H,3,4)/b10-9-;.
What are the key properties of acetic acid;(Z)-N-[2-(2-hydroxyethylamino)ethyl]octadec-9-enamide?
acetic acid;(Z)-N-[2-(2-hydroxyethylamino)ethyl]octadec-9-enamide has a molecular weight of 428.66 g/mol, XLogP of 4.81, 20 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(Z)-N-[2-(2-hydroxyethylamino)ethyl]octadec-9-enamide is sourced from PubChem (CID 6437526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).