C25H52O8 — CID 6437548
2-(2-hydroxyethoxy)ethanol;(Z)-octadec-9-enoic acid;propane-1,2,3-triol (PubChem CID 6437548) has the molecular formula C25H52O8 and a molecular weight of 480.68 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethanol;(Z)-octadec-9-enoic acid;propane-1,2,3-triol.
| Compound Name | 2-(2-hydroxyethoxy)ethanol;(Z)-octadec-9-enoic acid;propane-1,2,3-triol |
|---|---|
| PubChem CID | 6437548 |
| Molecular Formula | C25H52O8 |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.37 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethanol;(Z)-octadec-9-enoic acid;propane-1,2,3-triol |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.OCC(O)CO.OCCOCCO |
| InChI | InChI=1S/C18H34O2.C4H10O3.C3H8O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-3-7-4-2-6;4-1-3(6)2-5/h9-10H,2-8,11-17H2,1H3,(H,19,20);5-6H,1-4H2;3-6H,1-2H2/b10-9-;; |
| InChIKey | IOFMDFOFVYSWLA-XXAVUKJNSA-N |
| XLogP | 3.43 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|